C14H13N5O6 — CID 121059074
N-[2-(3-methyl-6-oxopyridazin-1-yl)ethyl]-3,5-dinitrobenzamide (PubChem CID 121059074) has the molecular formula C14H13N5O6 and a molecular weight of 347.29 g/mol. Its IUPAC name is N-[2-(3-methyl-6-oxopyridazin-1-yl)ethyl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-(3-methyl-6-oxopyridazin-1-yl)ethyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 121059074 |
| Molecular Formula | C14H13N5O6 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-[2-(3-methyl-6-oxopyridazin-1-yl)ethyl]-3,5-dinitrobenzamide |
| SMILES | Cc1ccc(=O)n(CCNC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C14H13N5O6/c1-9-2-3-13(20)17(16-9)5-4-15-14(21)10-6-11(18(22)23)8-12(7-10)19(24)25/h2-3,6-8H,4-5H2,1H3,(H,15,21) |
| InChIKey | BJHXXOFSIJRMOR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 150.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|