C18H19N5O6 — CID 121120469
N-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-3,5-dinitrobenzamide (PubChem CID 121120469) has the molecular formula C18H19N5O6 and a molecular weight of 401.38 g/mol. Its IUPAC name is N-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 121120469 |
| Molecular Formula | C18H19N5O6 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-3,5-dinitrobenzamide |
| SMILES | O=C(NCCn1cnc(C2CCCC2)cc1=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N5O6/c24-17-10-16(12-3-1-2-4-12)20-11-21(17)6-5-19-18(25)13-7-14(22(26)27)9-15(8-13)23(28)29/h7-12H,1-6H2,(H,19,25) |
| InChIKey | GATJLMWTBSSFHB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 150.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|