C20H25N3O4 — CID 121120244
N-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-2,4-dimethoxybenzamide (PubChem CID 121120244) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 121120244 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCn2cnc(C3CCCC3)cc2=O)c(OC)c1 |
| InChI | InChI=1S/C20H25N3O4/c1-26-15-7-8-16(18(11-15)27-2)20(25)21-9-10-23-13-22-17(12-19(23)24)14-5-3-4-6-14/h7-8,11-14H,3-6,9-10H2,1-2H3,(H,21,25) |
| InChIKey | VVGNQIABFMZDNG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |