C19H20N4O5 — CID 121062307
2-nitro-N-[4-[2-(propanoylamino)ethylcarbamoyl]phenyl]benzamide (PubChem CID 121062307) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is 2-nitro-N-[4-[2-(propanoylamino)ethylcarbamoyl]phenyl]benzamide.
| Compound Name | 2-nitro-N-[4-[2-(propanoylamino)ethylcarbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 121062307 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-nitro-N-[4-[2-(propanoylamino)ethylcarbamoyl]phenyl]benzamide |
| SMILES | CCC(=O)NCCNC(=O)c1ccc(NC(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H20N4O5/c1-2-17(24)20-11-12-21-18(25)13-7-9-14(10-8-13)22-19(26)15-5-3-4-6-16(15)23(27)28/h3-10H,2,11-12H2,1H3,(H,20,24)(H,21,25)(H,22,26) |
| InChIKey | LTVODFZQFOJQAJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|