C25H27N3O4S — CID 121063029
N-[2-[[4-[2-(3,5-dimethylphenoxy)propanoylamino]benzoyl]amino]ethyl]thiophene-2-carboxamide (PubChem CID 121063029) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is N-[2-[[4-[2-(3,5-dimethylphenoxy)propanoylamino]benzoyl]amino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[4-[2-(3,5-dimethylphenoxy)propanoylamino]benzoyl]amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 121063029 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-[2-[[4-[2-(3,5-dimethylphenoxy)propanoylamino]benzoyl]amino]ethyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(C)cc(OC(C)C(=O)Nc2ccc(C(=O)NCCNC(=O)c3cccs3)cc2)c1 |
| InChI | InChI=1S/C25H27N3O4S/c1-16-13-17(2)15-21(14-16)32-18(3)23(29)28-20-8-6-19(7-9-20)24(30)26-10-11-27-25(31)22-5-4-12-33-22/h4-9,12-15,18H,10-11H2,1-3H3,(H,26,30)(H,27,31)(H,28,29) |
| InChIKey | AMNQWAZJZFXPTO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|