C24H23N3O6S — CID 121062928
N-[2-[[4-[2-(1,3-benzodioxol-5-yloxy)propanoylamino]benzoyl]amino]ethyl]thiophene-2-carboxamide (PubChem CID 121062928) has the molecular formula C24H23N3O6S and a molecular weight of 481.53 g/mol. Its IUPAC name is N-[2-[[4-[2-(1,3-benzodioxol-5-yloxy)propanoylamino]benzoyl]amino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[4-[2-(1,3-benzodioxol-5-yloxy)propanoylamino]benzoyl]amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 121062928 |
| Molecular Formula | C24H23N3O6S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | N-[2-[[4-[2-(1,3-benzodioxol-5-yloxy)propanoylamino]benzoyl]amino]ethyl]thiophene-2-carboxamide |
| SMILES | CC(Oc1ccc2c(c1)OCO2)C(=O)Nc1ccc(C(=O)NCCNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C24H23N3O6S/c1-15(33-18-8-9-19-20(13-18)32-14-31-19)22(28)27-17-6-4-16(5-7-17)23(29)25-10-11-26-24(30)21-3-2-12-34-21/h2-9,12-13,15H,10-11,14H2,1H3,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | FQTULDUUFHGOOJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|