C23H21N3O6S — CID 121062930
N-[2-[[4-[[2-(1,3-benzodioxol-5-yloxy)acetyl]amino]benzoyl]amino]ethyl]thiophene-2-carboxamide (PubChem CID 121062930) has the molecular formula C23H21N3O6S and a molecular weight of 467.50 g/mol. Its IUPAC name is N-[2-[[4-[[2-(1,3-benzodioxol-5-yloxy)acetyl]amino]benzoyl]amino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[4-[[2-(1,3-benzodioxol-5-yloxy)acetyl]amino]benzoyl]amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 121062930 |
| Molecular Formula | C23H21N3O6S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N-[2-[[4-[[2-(1,3-benzodioxol-5-yloxy)acetyl]amino]benzoyl]amino]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(COc1ccc2c(c1)OCO2)Nc1ccc(C(=O)NCCNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C23H21N3O6S/c27-21(13-30-17-7-8-18-19(12-17)32-14-31-18)26-16-5-3-15(4-6-16)22(28)24-9-10-25-23(29)20-2-1-11-33-20/h1-8,11-12H,9-10,13-14H2,(H,24,28)(H,25,29)(H,26,27) |
| InChIKey | VWZRGYLSJASBJX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|