C28H27N3O4 — CID 121063810
2-[4-(4-ethoxyphenyl)-6-oxopyrimidin-1-yl]-N-[(4-phenylmethoxyphenyl)methyl]acetamide (PubChem CID 121063810) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)-6-oxopyrimidin-1-yl]-N-[(4-phenylmethoxyphenyl)methyl]acetamide.
| Compound Name | 2-[4-(4-ethoxyphenyl)-6-oxopyrimidin-1-yl]-N-[(4-phenylmethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 121063810 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)-6-oxopyrimidin-1-yl]-N-[(4-phenylmethoxyphenyl)methyl]acetamide |
| SMILES | CCOc1ccc(-c2cc(=O)n(CC(=O)NCc3ccc(OCc4ccccc4)cc3)cn2)cc1 |
| InChI | InChI=1S/C28H27N3O4/c1-2-34-24-14-10-23(11-15-24)26-16-28(33)31(20-30-26)18-27(32)29-17-21-8-12-25(13-9-21)35-19-22-6-4-3-5-7-22/h3-16,20H,2,17-19H2,1H3,(H,29,32) |
| InChIKey | XTMGFDTYFMGUJK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |