C21H17F3IN3O2 — CID 121069157
(2-iodophenyl)-[3-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methanone (PubChem CID 121069157) has the molecular formula C21H17F3IN3O2 and a molecular weight of 527.28 g/mol. Its IUPAC name is (2-iodophenyl)-[3-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methanone.
| Compound Name | (2-iodophenyl)-[3-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 121069157 |
| Molecular Formula | C21H17F3IN3O2 |
| Molecular Weight | 527.28 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | (2-iodophenyl)-[3-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1I)N1CCCC(c2nnc(-c3ccc(C(F)(F)F)cc3)o2)C1 |
| InChI | InChI=1S/C21H17F3IN3O2/c22-21(23,24)15-9-7-13(8-10-15)18-26-27-19(30-18)14-4-3-11-28(12-14)20(29)16-5-1-2-6-17(16)25/h1-2,5-10,14H,3-4,11-12H2 |
| InChIKey | VGDYBNOOMRIMOB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.28 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|