C24H18F3N3O4 — CID 121069268
3-[3-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]piperidine-1-carbonyl]chromen-2-one (PubChem CID 121069268) has the molecular formula C24H18F3N3O4 and a molecular weight of 469.42 g/mol. Its IUPAC name is 3-[3-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]piperidine-1-carbonyl]chromen-2-one.
| Compound Name | 3-[3-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]piperidine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 121069268 |
| Molecular Formula | C24H18F3N3O4 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 3-[3-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]piperidine-1-carbonyl]chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)N1CCCC(c2nnc(-c3ccc(C(F)(F)F)cc3)o2)C1 |
| InChI | InChI=1S/C24H18F3N3O4/c25-24(26,27)17-9-7-14(8-10-17)20-28-29-21(34-20)16-5-3-11-30(13-16)22(31)18-12-15-4-1-2-6-19(15)33-23(18)32/h1-2,4,6-10,12,16H,3,5,11,13H2 |
| InChIKey | QRSHMLAXELQWLM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 89.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|