C23H18FN3O3S — CID 90491152
3-[3-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]piperidine-1-carbonyl]chromen-2-one (PubChem CID 90491152) has the molecular formula C23H18FN3O3S and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-[3-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]piperidine-1-carbonyl]chromen-2-one.
| Compound Name | 3-[3-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]piperidine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 90491152 |
| Molecular Formula | C23H18FN3O3S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 3-[3-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]piperidine-1-carbonyl]chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)N1CCCC(c2nnc(-c3ccccc3F)s2)C1 |
| InChI | InChI=1S/C23H18FN3O3S/c24-18-9-3-2-8-16(18)21-26-25-20(31-21)15-7-5-11-27(13-15)22(28)17-12-14-6-1-4-10-19(14)30-23(17)29/h1-4,6,8-10,12,15H,5,7,11,13H2 |
| InChIKey | VLZNKEAVUWQDIC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|