C22H18F3NO3 — CID 95788781
3-[(2R)-2-[4-(trifluoromethyl)phenyl]piperidine-1-carbonyl]chromen-2-one (PubChem CID 95788781) has the molecular formula C22H18F3NO3 and a molecular weight of 401.38 g/mol. Its IUPAC name is 3-[(2R)-2-[4-(trifluoromethyl)phenyl]piperidine-1-carbonyl]chromen-2-one.
| Compound Name | 3-[(2R)-2-[4-(trifluoromethyl)phenyl]piperidine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 95788781 |
| Molecular Formula | C22H18F3NO3 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 3-[(2R)-2-[4-(trifluoromethyl)phenyl]piperidine-1-carbonyl]chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)N1CCCC[C@@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18F3NO3/c23-22(24,25)16-10-8-14(9-11-16)18-6-3-4-12-26(18)20(27)17-13-15-5-1-2-7-19(15)29-21(17)28/h1-2,5,7-11,13,18H,3-4,6,12H2/t18-/m1/s1 |
| InChIKey | BAITXEHXPVYVCH-GOSISDBHSA-N |
| XLogP | 5.18 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|