C23H21NO5 — CID 18097487
3-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidine-1-carbonyl]chromen-2-one (PubChem CID 18097487) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is 3-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidine-1-carbonyl]chromen-2-one.
| Compound Name | 3-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 18097487 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidine-1-carbonyl]chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)N1CCCC1c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C23H21NO5/c25-22(17-13-16-5-1-2-7-19(16)29-23(17)26)24-10-3-6-18(24)15-8-9-20-21(14-15)28-12-4-11-27-20/h1-2,5,7-9,13-14,18H,3-4,6,10-12H2 |
| InChIKey | UGNHMBCMGNTNGY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|