C19H18F4N2O — CID 52516414
(2R)-N-(2-fluorophenyl)-2-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 52516414) has the molecular formula C19H18F4N2O and a molecular weight of 366.36 g/mol. Its IUPAC name is (2R)-N-(2-fluorophenyl)-2-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | (2R)-N-(2-fluorophenyl)-2-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 52516414 |
| Molecular Formula | C19H18F4N2O |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (2R)-N-(2-fluorophenyl)-2-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1F)N1CCCC[C@@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F4N2O/c20-15-5-1-2-6-16(15)24-18(26)25-12-4-3-7-17(25)13-8-10-14(11-9-13)19(21,22)23/h1-2,5-6,8-11,17H,3-4,7,12H2,(H,24,26)/t17-/m1/s1 |
| InChIKey | JOLNDSCESPSCDW-QGZVFWFLSA-N |
| XLogP | 5.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |