C30H30N4O2 — CID 121070397
N-benzhydryl-1-[6-(4-methoxyphenyl)pyridazin-3-yl]piperidine-3-carboxamide (PubChem CID 121070397) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is N-benzhydryl-1-[6-(4-methoxyphenyl)pyridazin-3-yl]piperidine-3-carboxamide.
| Compound Name | N-benzhydryl-1-[6-(4-methoxyphenyl)pyridazin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121070397 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | N-benzhydryl-1-[6-(4-methoxyphenyl)pyridazin-3-yl]piperidine-3-carboxamide |
| SMILES | COc1ccc(-c2ccc(N3CCCC(C(=O)NC(c4ccccc4)c4ccccc4)C3)nn2)cc1 |
| InChI | InChI=1S/C30H30N4O2/c1-36-26-16-14-22(15-17-26)27-18-19-28(33-32-27)34-20-8-13-25(21-34)30(35)31-29(23-9-4-2-5-10-23)24-11-6-3-7-12-24/h2-7,9-12,14-19,25,29H,8,13,20-21H2,1H3,(H,31,35) |
| InChIKey | SNHVARJNHDLIDI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |