C25H32N8O3 — CID 121071514
1-[6-(furan-2-yl)pyridazin-3-yl]-N-[2-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]oxyethyl]piperidine-3-carboxamide (PubChem CID 121071514) has the molecular formula C25H32N8O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is 1-[6-(furan-2-yl)pyridazin-3-yl]-N-[2-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]oxyethyl]piperidine-3-carboxamide.
| Compound Name | 1-[6-(furan-2-yl)pyridazin-3-yl]-N-[2-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]oxyethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121071514 |
| Molecular Formula | C25H32N8O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 1-[6-(furan-2-yl)pyridazin-3-yl]-N-[2-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]oxyethyl]piperidine-3-carboxamide |
| SMILES | CN1CCN(c2cc(OCCNC(=O)C3CCCN(c4ccc(-c5ccco5)nn4)C3)ncn2)CC1 |
| InChI | InChI=1S/C25H32N8O3/c1-31-10-12-32(13-11-31)23-16-24(28-18-27-23)36-15-8-26-25(34)19-4-2-9-33(17-19)22-7-6-20(29-30-22)21-5-3-14-35-21/h3,5-7,14,16,18-19H,2,4,8-13,15,17H2,1H3,(H,26,34) |
| InChIKey | IGJIAFHTCVIGSF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 112.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|