C21H21FN4O2 — CID 121071493
N-[(2-fluorophenyl)methyl]-1-[6-(furan-2-yl)pyridazin-3-yl]piperidine-3-carboxamide (PubChem CID 121071493) has the molecular formula C21H21FN4O2 and a molecular weight of 380.42 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-1-[6-(furan-2-yl)pyridazin-3-yl]piperidine-3-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-1-[6-(furan-2-yl)pyridazin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121071493 |
| Molecular Formula | C21H21FN4O2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-1-[6-(furan-2-yl)pyridazin-3-yl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1F)C1CCCN(c2ccc(-c3ccco3)nn2)C1 |
| InChI | InChI=1S/C21H21FN4O2/c22-17-7-2-1-5-15(17)13-23-21(27)16-6-3-11-26(14-16)20-10-9-18(24-25-20)19-8-4-12-28-19/h1-2,4-5,7-10,12,16H,3,6,11,13-14H2,(H,23,27) |
| InChIKey | AXVPCLNYXYYIDM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |