C19H25N5O3 — CID 46329045
N-(furan-2-ylmethyl)-1-(6-morpholin-4-ylpyridazin-3-yl)piperidine-3-carboxamide (PubChem CID 46329045) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-(6-morpholin-4-ylpyridazin-3-yl)piperidine-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-(6-morpholin-4-ylpyridazin-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46329045 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-(6-morpholin-4-ylpyridazin-3-yl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccco1)C1CCCN(c2ccc(N3CCOCC3)nn2)C1 |
| InChI | InChI=1S/C19H25N5O3/c25-19(20-13-16-4-2-10-27-16)15-3-1-7-24(14-15)18-6-5-17(21-22-18)23-8-11-26-12-9-23/h2,4-6,10,15H,1,3,7-9,11-14H2,(H,20,25) |
| InChIKey | KJASQOLCMGEWGC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |