C21H30N6O2 — CID 46329039
1-[6-(4-ethylpiperazin-1-yl)pyridazin-3-yl]-N-(furan-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 46329039) has the molecular formula C21H30N6O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-[6-(4-ethylpiperazin-1-yl)pyridazin-3-yl]-N-(furan-2-ylmethyl)piperidine-3-carboxamide.
| Compound Name | 1-[6-(4-ethylpiperazin-1-yl)pyridazin-3-yl]-N-(furan-2-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46329039 |
| Molecular Formula | C21H30N6O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 1-[6-(4-ethylpiperazin-1-yl)pyridazin-3-yl]-N-(furan-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | CCN1CCN(c2ccc(N3CCCC(C(=O)NCc4ccco4)C3)nn2)CC1 |
| InChI | InChI=1S/C21H30N6O2/c1-2-25-10-12-26(13-11-25)19-7-8-20(24-23-19)27-9-3-5-17(16-27)21(28)22-15-18-6-4-14-29-18/h4,6-8,14,17H,2-3,5,9-13,15-16H2,1H3,(H,22,28) |
| InChIKey | OOSUXUFZXOLFGK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |