C20H30N6O — CID 121072377
3-cyclohexyl-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]propanamide (PubChem CID 121072377) has the molecular formula C20H30N6O and a molecular weight of 370.50 g/mol. Its IUPAC name is 3-cyclohexyl-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 121072377 |
| Molecular Formula | C20H30N6O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 3-cyclohexyl-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]propanamide |
| SMILES | Cc1cc(C)n(-c2cc(NCCNC(=O)CCC3CCCCC3)ncn2)n1 |
| InChI | InChI=1S/C20H30N6O/c1-15-12-16(2)26(25-15)19-13-18(23-14-24-19)21-10-11-22-20(27)9-8-17-6-4-3-5-7-17/h12-14,17H,3-11H2,1-2H3,(H,22,27)(H,21,23,24) |
| InChIKey | IHKMRMATYMCCLU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|