C18H19N5O2S2 — CID 121075974
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[3-(4-methylphenyl)-6-oxopyridazin-1-yl]propanamide (PubChem CID 121075974) has the molecular formula C18H19N5O2S2 and a molecular weight of 401.52 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[3-(4-methylphenyl)-6-oxopyridazin-1-yl]propanamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[3-(4-methylphenyl)-6-oxopyridazin-1-yl]propanamide |
|---|---|
| PubChem CID | 121075974 |
| Molecular Formula | C18H19N5O2S2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[3-(4-methylphenyl)-6-oxopyridazin-1-yl]propanamide |
| SMILES | CCSc1nnc(NC(=O)C(C)n2nc(-c3ccc(C)cc3)ccc2=O)s1 |
| InChI | InChI=1S/C18H19N5O2S2/c1-4-26-18-21-20-17(27-18)19-16(25)12(3)23-15(24)10-9-14(22-23)13-7-5-11(2)6-8-13/h5-10,12H,4H2,1-3H3,(H,19,20,25) |
| InChIKey | ZFGMXPJMGHHGLJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|