C18H18N4O4S2 — CID 121076871
2-methyl-2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-(4-sulfamoylphenyl)propanamide (PubChem CID 121076871) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-methyl-2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 2-methyl-2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 121076871 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 2-methyl-2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-(4-sulfamoylphenyl)propanamide |
| SMILES | CC(C)(C(=O)Nc1ccc(S(N)(=O)=O)cc1)n1nc(-c2cccs2)ccc1=O |
| InChI | InChI=1S/C18H18N4O4S2/c1-18(2,17(24)20-12-5-7-13(8-6-12)28(19,25)26)22-16(23)10-9-14(21-22)15-4-3-11-27-15/h3-11H,1-2H3,(H,20,24)(H2,19,25,26) |
| InChIKey | ZMLYBEMJNOUNAS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |