C36H37N3O6 — CID 121079280
oxalic acid;2-(phenoxymethyl)-1-[[1-[(4-phenylmethoxyphenyl)methyl]piperidin-4-yl]methyl]benzimidazole (PubChem CID 121079280) has the molecular formula C36H37N3O6 and a molecular weight of 607.71 g/mol. Its IUPAC name is oxalic acid;2-(phenoxymethyl)-1-[[1-[(4-phenylmethoxyphenyl)methyl]piperidin-4-yl]methyl]benzimidazole.
| Compound Name | oxalic acid;2-(phenoxymethyl)-1-[[1-[(4-phenylmethoxyphenyl)methyl]piperidin-4-yl]methyl]benzimidazole |
|---|---|
| PubChem CID | 121079280 |
| Molecular Formula | C36H37N3O6 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | oxalic acid;2-(phenoxymethyl)-1-[[1-[(4-phenylmethoxyphenyl)methyl]piperidin-4-yl]methyl]benzimidazole |
| SMILES | O=C(O)C(=O)O.c1ccc(COc2ccc(CN3CCC(Cn4c(COc5ccccc5)nc5ccccc54)CC3)cc2)cc1 |
| InChI | InChI=1S/C34H35N3O2.C2H2O4/c1-3-9-29(10-4-1)25-38-31-17-15-27(16-18-31)23-36-21-19-28(20-22-36)24-37-33-14-8-7-13-32(33)35-34(37)26-39-30-11-5-2-6-12-30;3-1(4)2(5)6/h1-18,28H,19-26H2;(H,3,4)(H,5,6) |
| InChIKey | IABVVVAEBVRMOJ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|