C31H31F3N4O7 — CID 121079288
oxalic acid;2-[4-[[2-(phenoxymethyl)benzimidazol-1-yl]methyl]piperidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 121079288) has the molecular formula C31H31F3N4O7 and a molecular weight of 628.60 g/mol. Its IUPAC name is oxalic acid;2-[4-[[2-(phenoxymethyl)benzimidazol-1-yl]methyl]piperidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | oxalic acid;2-[4-[[2-(phenoxymethyl)benzimidazol-1-yl]methyl]piperidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 121079288 |
| Molecular Formula | C31H31F3N4O7 |
| Molecular Weight | 628.60 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | oxalic acid;2-[4-[[2-(phenoxymethyl)benzimidazol-1-yl]methyl]piperidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CN1CCC(Cn2c(COc3ccccc3)nc3ccccc32)CC1)Nc1ccc(OC(F)(F)F)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H29F3N4O3.C2H2O4/c30-29(31,32)39-24-12-10-22(11-13-24)33-28(37)19-35-16-14-21(15-17-35)18-36-26-9-5-4-8-25(26)34-27(36)20-38-23-6-2-1-3-7-23;3-1(4)2(5)6/h1-13,21H,14-20H2,(H,33,37);(H,3,4)(H,5,6) |
| InChIKey | VLURXOQNIQIYKV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|