C26H30N4O7 — CID 71780915
methyl 4-[[2-[4-[(2-methylbenzimidazol-1-yl)methyl]piperidin-1-yl]acetyl]amino]benzoate;oxalic acid (PubChem CID 71780915) has the molecular formula C26H30N4O7 and a molecular weight of 510.55 g/mol. Its IUPAC name is methyl 4-[[2-[4-[(2-methylbenzimidazol-1-yl)methyl]piperidin-1-yl]acetyl]amino]benzoate;oxalic acid.
| Compound Name | methyl 4-[[2-[4-[(2-methylbenzimidazol-1-yl)methyl]piperidin-1-yl]acetyl]amino]benzoate;oxalic acid |
|---|---|
| PubChem CID | 71780915 |
| Molecular Formula | C26H30N4O7 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | methyl 4-[[2-[4-[(2-methylbenzimidazol-1-yl)methyl]piperidin-1-yl]acetyl]amino]benzoate;oxalic acid |
| SMILES | COC(=O)c1ccc(NC(=O)CN2CCC(Cn3c(C)nc4ccccc43)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H28N4O3.C2H2O4/c1-17-25-21-5-3-4-6-22(21)28(17)15-18-11-13-27(14-12-18)16-23(29)26-20-9-7-19(8-10-20)24(30)31-2;3-1(4)2(5)6/h3-10,18H,11-16H2,1-2H3,(H,26,29);(H,3,4)(H,5,6) |
| InChIKey | CCXXJRDVOMDVAF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|