C24H27N3O6 — CID 71780888
methyl 4-[[4-(benzimidazol-1-ylmethyl)piperidin-1-yl]methyl]benzoate;oxalic acid (PubChem CID 71780888) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is methyl 4-[[4-(benzimidazol-1-ylmethyl)piperidin-1-yl]methyl]benzoate;oxalic acid.
| Compound Name | methyl 4-[[4-(benzimidazol-1-ylmethyl)piperidin-1-yl]methyl]benzoate;oxalic acid |
|---|---|
| PubChem CID | 71780888 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | methyl 4-[[4-(benzimidazol-1-ylmethyl)piperidin-1-yl]methyl]benzoate;oxalic acid |
| SMILES | COC(=O)c1ccc(CN2CCC(Cn3cnc4ccccc43)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H25N3O2.C2H2O4/c1-27-22(26)19-8-6-17(7-9-19)14-24-12-10-18(11-13-24)15-25-16-23-20-4-2-3-5-21(20)25;3-1(4)2(5)6/h2-9,16,18H,10-15H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | IPRMJKIOKWWTOA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|