C24H32N2O3 — CID 162356120
methyl 4-[3-[(1-benzylpiperidin-4-yl)methylamino]-3-hydroxypropyl]benzoate (PubChem CID 162356120) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is methyl 4-[3-[(1-benzylpiperidin-4-yl)methylamino]-3-hydroxypropyl]benzoate.
| Compound Name | methyl 4-[3-[(1-benzylpiperidin-4-yl)methylamino]-3-hydroxypropyl]benzoate |
|---|---|
| PubChem CID | 162356120 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | methyl 4-[3-[(1-benzylpiperidin-4-yl)methylamino]-3-hydroxypropyl]benzoate |
| SMILES | COC(=O)c1ccc(CCC(O)NCC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H32N2O3/c1-29-24(28)22-10-7-19(8-11-22)9-12-23(27)25-17-20-13-15-26(16-14-20)18-21-5-3-2-4-6-21/h2-8,10-11,20,23,25,27H,9,12-18H2,1H3 |
| InChIKey | NZBSABVBOPQXAJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|