C26H37N5O3 — CID 122625901
4-[[4-[[[3-(benzylamino)-2-hydrazinylpentanoyl]amino]methyl]piperidin-1-yl]methyl]benzoic acid (PubChem CID 122625901) has the molecular formula C26H37N5O3 and a molecular weight of 467.61 g/mol. Its IUPAC name is 4-[[4-[[[3-(benzylamino)-2-hydrazinylpentanoyl]amino]methyl]piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-[[[3-(benzylamino)-2-hydrazinylpentanoyl]amino]methyl]piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122625901 |
| Molecular Formula | C26H37N5O3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | 4-[[4-[[[3-(benzylamino)-2-hydrazinylpentanoyl]amino]methyl]piperidin-1-yl]methyl]benzoic acid |
| SMILES | CCC(NCc1ccccc1)C(NN)C(=O)NCC1CCN(Cc2ccc(C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C26H37N5O3/c1-2-23(28-16-19-6-4-3-5-7-19)24(30-27)25(32)29-17-20-12-14-31(15-13-20)18-21-8-10-22(11-9-21)26(33)34/h3-11,20,23-24,28,30H,2,12-18,27H2,1H3,(H,29,32)(H,33,34) |
| InChIKey | QXMXWXVCSHYGPF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|