C23H23N7O5 — CID 121090446
N-[4-[(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]-3,5-dinitrobenzamide (PubChem CID 121090446) has the molecular formula C23H23N7O5 and a molecular weight of 477.48 g/mol. Its IUPAC name is N-[4-[(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[4-[(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 121090446 |
| Molecular Formula | C23H23N7O5 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[4-[(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]-3,5-dinitrobenzamide |
| SMILES | Cc1cc(Nc2ccc(NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C23H23N7O5/c1-15-11-21(27-23(24-15)28-9-3-2-4-10-28)25-17-5-7-18(8-6-17)26-22(31)16-12-19(29(32)33)14-20(13-16)30(34)35/h5-8,11-14H,2-4,9-10H2,1H3,(H,26,31)(H,24,25,27) |
| InChIKey | XEFRLRGHOAZSDD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|