C20H19ClN4O3 — CID 121090524
3-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-(furan-2-yl)pyrimidin-4-one (PubChem CID 121090524) has the molecular formula C20H19ClN4O3 and a molecular weight of 398.85 g/mol. Its IUPAC name is 3-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-(furan-2-yl)pyrimidin-4-one.
| Compound Name | 3-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-(furan-2-yl)pyrimidin-4-one |
|---|---|
| PubChem CID | 121090524 |
| Molecular Formula | C20H19ClN4O3 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 3-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-6-(furan-2-yl)pyrimidin-4-one |
| SMILES | O=C(Cn1cnc(-c2ccco2)cc1=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H19ClN4O3/c21-15-3-1-4-16(11-15)23-6-8-24(9-7-23)20(27)13-25-14-22-17(12-19(25)26)18-5-2-10-28-18/h1-5,10-12,14H,6-9,13H2 |
| InChIKey | OGQJXBNPQKZHKV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |