C22H24N4O2 — CID 121093224
3-(3-benzyl-1,2,4-oxadiazol-5-yl)-N-(3-phenylpropyl)azetidine-1-carboxamide (PubChem CID 121093224) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-(3-benzyl-1,2,4-oxadiazol-5-yl)-N-(3-phenylpropyl)azetidine-1-carboxamide.
| Compound Name | 3-(3-benzyl-1,2,4-oxadiazol-5-yl)-N-(3-phenylpropyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 121093224 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3-(3-benzyl-1,2,4-oxadiazol-5-yl)-N-(3-phenylpropyl)azetidine-1-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)N1CC(c2nc(Cc3ccccc3)no2)C1 |
| InChI | InChI=1S/C22H24N4O2/c27-22(23-13-7-12-17-8-3-1-4-9-17)26-15-19(16-26)21-24-20(25-28-21)14-18-10-5-2-6-11-18/h1-6,8-11,19H,7,12-16H2,(H,23,27) |
| InChIKey | NATOSRUPBQHALT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|