C28H28N4O3 — CID 121106826
1-[4-[6-(4-ethoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]-2-naphthalen-2-yloxyethanone (PubChem CID 121106826) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 1-[4-[6-(4-ethoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]-2-naphthalen-2-yloxyethanone.
| Compound Name | 1-[4-[6-(4-ethoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]-2-naphthalen-2-yloxyethanone |
|---|---|
| PubChem CID | 121106826 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 1-[4-[6-(4-ethoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]-2-naphthalen-2-yloxyethanone |
| SMILES | CCOc1ccc(-c2cc(N3CCN(C(=O)COc4ccc5ccccc5c4)CC3)ncn2)cc1 |
| InChI | InChI=1S/C28H28N4O3/c1-2-34-24-10-8-22(9-11-24)26-18-27(30-20-29-26)31-13-15-32(16-14-31)28(33)19-35-25-12-7-21-5-3-4-6-23(21)17-25/h3-12,17-18,20H,2,13-16,19H2,1H3 |
| InChIKey | OJINCGUAQXZEQN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |