C24H26N4O4 — CID 90516931
2-(2-methoxyphenoxy)-1-[4-[6-(4-methoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]ethanone (PubChem CID 90516931) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-1-[4-[6-(4-methoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-(2-methoxyphenoxy)-1-[4-[6-(4-methoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 90516931 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-(2-methoxyphenoxy)-1-[4-[6-(4-methoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]ethanone |
| SMILES | COc1ccc(-c2cc(N3CCN(C(=O)COc4ccccc4OC)CC3)ncn2)cc1 |
| InChI | InChI=1S/C24H26N4O4/c1-30-19-9-7-18(8-10-19)20-15-23(26-17-25-20)27-11-13-28(14-12-27)24(29)16-32-22-6-4-3-5-21(22)31-2/h3-10,15,17H,11-14,16H2,1-2H3 |
| InChIKey | DNDJZJKAEXRSFL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |