C30H28N4O3 — CID 121106863
[4-[6-(4-ethoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]-(9H-xanthen-9-yl)methanone (PubChem CID 121106863) has the molecular formula C30H28N4O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is [4-[6-(4-ethoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]-(9H-xanthen-9-yl)methanone.
| Compound Name | [4-[6-(4-ethoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]-(9H-xanthen-9-yl)methanone |
|---|---|
| PubChem CID | 121106863 |
| Molecular Formula | C30H28N4O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | [4-[6-(4-ethoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]-(9H-xanthen-9-yl)methanone |
| SMILES | CCOc1ccc(-c2cc(N3CCN(C(=O)C4c5ccccc5Oc5ccccc54)CC3)ncn2)cc1 |
| InChI | InChI=1S/C30H28N4O3/c1-2-36-22-13-11-21(12-14-22)25-19-28(32-20-31-25)33-15-17-34(18-16-33)30(35)29-23-7-3-5-9-26(23)37-27-10-6-4-8-24(27)29/h3-14,19-20,29H,2,15-18H2,1H3 |
| InChIKey | QSGBHPKEBYCXAV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |