C17H20N4O4S — CID 121108163
2-nitro-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzenesulfonamide (PubChem CID 121108163) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is 2-nitro-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzenesulfonamide.
| Compound Name | 2-nitro-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121108163 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-nitro-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NCC1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C17H20N4O4S/c22-21(23)16-3-1-2-4-17(16)26(24,25)19-13-14-7-11-20(12-8-14)15-5-9-18-10-6-15/h1-6,9-10,14,19H,7-8,11-13H2 |
| InChIKey | JPVLKMCYNICPDZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|