C17H21N3O4S2 — CID 121108182
methyl 3-[(1-pyridin-4-ylpiperidin-4-yl)methylsulfamoyl]thiophene-2-carboxylate (PubChem CID 121108182) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is methyl 3-[(1-pyridin-4-ylpiperidin-4-yl)methylsulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(1-pyridin-4-ylpiperidin-4-yl)methylsulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 121108182 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | methyl 3-[(1-pyridin-4-ylpiperidin-4-yl)methylsulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NCC1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-24-17(21)16-15(6-11-25-16)26(22,23)19-12-13-4-9-20(10-5-13)14-2-7-18-8-3-14/h2-3,6-8,11,13,19H,4-5,9-10,12H2,1H3 |
| InChIKey | FWHQAWYZFKZWLT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |