C26H38N4O4 — CID 121109702
N'-[1-(2-methylpropanoyl)-3,4-dihydro-2H-quinolin-7-yl]-N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]oxamide (PubChem CID 121109702) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is N'-[1-(2-methylpropanoyl)-3,4-dihydro-2H-quinolin-7-yl]-N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-[1-(2-methylpropanoyl)-3,4-dihydro-2H-quinolin-7-yl]-N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 121109702 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | N'-[1-(2-methylpropanoyl)-3,4-dihydro-2H-quinolin-7-yl]-N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]oxamide |
| SMILES | CC(C)C(=O)N1CCCc2ccc(NC(=O)C(=O)NCC3CCN(C4CCOCC4)CC3)cc21 |
| InChI | InChI=1S/C26H38N4O4/c1-18(2)26(33)30-11-3-4-20-5-6-21(16-23(20)30)28-25(32)24(31)27-17-19-7-12-29(13-8-19)22-9-14-34-15-10-22/h5-6,16,18-19,22H,3-4,7-15,17H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | WIPLYLJDWSSONZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|