C25H30FN3O4 — CID 90599391
N-[2-(2-fluorophenyl)-2-methoxypropyl]-N'-[1-(2-methylpropanoyl)-3,4-dihydro-2H-quinolin-7-yl]oxamide (PubChem CID 90599391) has the molecular formula C25H30FN3O4 and a molecular weight of 455.53 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-2-methoxypropyl]-N'-[1-(2-methylpropanoyl)-3,4-dihydro-2H-quinolin-7-yl]oxamide.
| Compound Name | N-[2-(2-fluorophenyl)-2-methoxypropyl]-N'-[1-(2-methylpropanoyl)-3,4-dihydro-2H-quinolin-7-yl]oxamide |
|---|---|
| PubChem CID | 90599391 |
| Molecular Formula | C25H30FN3O4 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-[2-(2-fluorophenyl)-2-methoxypropyl]-N'-[1-(2-methylpropanoyl)-3,4-dihydro-2H-quinolin-7-yl]oxamide |
| SMILES | COC(C)(CNC(=O)C(=O)Nc1ccc2c(c1)N(C(=O)C(C)C)CCC2)c1ccccc1F |
| InChI | InChI=1S/C25H30FN3O4/c1-16(2)24(32)29-13-7-8-17-11-12-18(14-21(17)29)28-23(31)22(30)27-15-25(3,33-4)19-9-5-6-10-20(19)26/h5-6,9-12,14,16H,7-8,13,15H2,1-4H3,(H,27,30)(H,28,31) |
| InChIKey | WYXKYXIIHRIQPA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|