C26H26FN3O4S — CID 90599393
N-[2-(2-fluorophenyl)-2-methoxypropyl]-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide (PubChem CID 90599393) has the molecular formula C26H26FN3O4S and a molecular weight of 495.58 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-2-methoxypropyl]-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide.
| Compound Name | N-[2-(2-fluorophenyl)-2-methoxypropyl]-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide |
|---|---|
| PubChem CID | 90599393 |
| Molecular Formula | C26H26FN3O4S |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | N-[2-(2-fluorophenyl)-2-methoxypropyl]-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide |
| SMILES | COC(C)(CNC(=O)C(=O)Nc1ccc2c(c1)CCCN2C(=O)c1cccs1)c1ccccc1F |
| InChI | InChI=1S/C26H26FN3O4S/c1-26(34-2,19-8-3-4-9-20(19)27)16-28-23(31)24(32)29-18-11-12-21-17(15-18)7-5-13-30(21)25(33)22-10-6-14-35-22/h3-4,6,8-12,14-15H,5,7,13,16H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | DTXJOQJMQMNZOO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|