C25H25N3O4S — CID 90534609
N-(2-hydroxy-3-phenylpropyl)-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide (PubChem CID 90534609) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-(2-hydroxy-3-phenylpropyl)-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide.
| Compound Name | N-(2-hydroxy-3-phenylpropyl)-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide |
|---|---|
| PubChem CID | 90534609 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-(2-hydroxy-3-phenylpropyl)-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide |
| SMILES | O=C(NCC(O)Cc1ccccc1)C(=O)Nc1ccc2c(c1)CCCN2C(=O)c1cccs1 |
| InChI | InChI=1S/C25H25N3O4S/c29-20(14-17-6-2-1-3-7-17)16-26-23(30)24(31)27-19-10-11-21-18(15-19)8-4-12-28(21)25(32)22-9-5-13-33-22/h1-3,5-7,9-11,13,15,20,29H,4,8,12,14,16H2,(H,26,30)(H,27,31) |
| InChIKey | FGIFVOHMTWUUFW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|