C23H23N3O4S2 — CID 71787892
N-(3-hydroxy-3-thiophen-2-ylpropyl)-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide (PubChem CID 71787892) has the molecular formula C23H23N3O4S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-(3-hydroxy-3-thiophen-2-ylpropyl)-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide.
| Compound Name | N-(3-hydroxy-3-thiophen-2-ylpropyl)-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide |
|---|---|
| PubChem CID | 71787892 |
| Molecular Formula | C23H23N3O4S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-(3-hydroxy-3-thiophen-2-ylpropyl)-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide |
| SMILES | O=C(NCCC(O)c1cccs1)C(=O)Nc1ccc2c(c1)CCCN2C(=O)c1cccs1 |
| InChI | InChI=1S/C23H23N3O4S2/c27-18(19-5-2-12-31-19)9-10-24-21(28)22(29)25-16-7-8-17-15(14-16)4-1-11-26(17)23(30)20-6-3-13-32-20/h2-3,5-8,12-14,18,27H,1,4,9-11H2,(H,24,28)(H,25,29) |
| InChIKey | ARQRZLGGIJRQKM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|