C27H29N3O4S — CID 121112407
N-(5-hydroxy-3-phenylpentyl)-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide (PubChem CID 121112407) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is N-(5-hydroxy-3-phenylpentyl)-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide.
| Compound Name | N-(5-hydroxy-3-phenylpentyl)-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide |
|---|---|
| PubChem CID | 121112407 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-(5-hydroxy-3-phenylpentyl)-N'-[1-(thiophene-2-carbonyl)-3,4-dihydro-2H-quinolin-6-yl]oxamide |
| SMILES | O=C(NCCC(CCO)c1ccccc1)C(=O)Nc1ccc2c(c1)CCCN2C(=O)c1cccs1 |
| InChI | InChI=1S/C27H29N3O4S/c31-16-13-20(19-6-2-1-3-7-19)12-14-28-25(32)26(33)29-22-10-11-23-21(18-22)8-4-15-30(23)27(34)24-9-5-17-35-24/h1-3,5-7,9-11,17-18,20,31H,4,8,12-16H2,(H,28,32)(H,29,33) |
| InChIKey | NHGVWVKVJADZMS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|