C22H17F6NO2 — CID 121110209
N-(3-hydroxy-3-naphthalen-1-ylpropyl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 121110209) has the molecular formula C22H17F6NO2 and a molecular weight of 441.37 g/mol. Its IUPAC name is N-(3-hydroxy-3-naphthalen-1-ylpropyl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(3-hydroxy-3-naphthalen-1-ylpropyl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 121110209 |
| Molecular Formula | C22H17F6NO2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | N-(3-hydroxy-3-naphthalen-1-ylpropyl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCCC(O)c1cccc2ccccc12)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H17F6NO2/c23-21(24,25)15-10-14(11-16(12-15)22(26,27)28)20(31)29-9-8-19(30)18-7-3-5-13-4-1-2-6-17(13)18/h1-7,10-12,19,30H,8-9H2,(H,29,31) |
| InChIKey | YGQJQROUEXEETG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |