C26H26N4O4 — CID 121115512
2-benzyl-4-ethyl-5-[1-(2-oxochromene-3-carbonyl)piperidin-4-yl]-1,2,4-triazol-3-one (PubChem CID 121115512) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-benzyl-4-ethyl-5-[1-(2-oxochromene-3-carbonyl)piperidin-4-yl]-1,2,4-triazol-3-one.
| Compound Name | 2-benzyl-4-ethyl-5-[1-(2-oxochromene-3-carbonyl)piperidin-4-yl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 121115512 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-benzyl-4-ethyl-5-[1-(2-oxochromene-3-carbonyl)piperidin-4-yl]-1,2,4-triazol-3-one |
| SMILES | CCn1c(C2CCN(C(=O)c3cc4ccccc4oc3=O)CC2)nn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C26H26N4O4/c1-2-29-23(27-30(26(29)33)17-18-8-4-3-5-9-18)19-12-14-28(15-13-19)24(31)21-16-20-10-6-7-11-22(20)34-25(21)32/h3-11,16,19H,2,12-15,17H2,1H3 |
| InChIKey | JJMBZKHLIXEOHP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|