C21H27N5O5 — CID 121115761
4-cyclopropyl-2-(2-methoxyethyl)-5-[1-(4-methyl-3-nitrobenzoyl)piperidin-3-yl]-1,2,4-triazol-3-one (PubChem CID 121115761) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is 4-cyclopropyl-2-(2-methoxyethyl)-5-[1-(4-methyl-3-nitrobenzoyl)piperidin-3-yl]-1,2,4-triazol-3-one.
| Compound Name | 4-cyclopropyl-2-(2-methoxyethyl)-5-[1-(4-methyl-3-nitrobenzoyl)piperidin-3-yl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 121115761 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 4-cyclopropyl-2-(2-methoxyethyl)-5-[1-(4-methyl-3-nitrobenzoyl)piperidin-3-yl]-1,2,4-triazol-3-one |
| SMILES | COCCn1nc(C2CCCN(C(=O)c3ccc(C)c([N+](=O)[O-])c3)C2)n(C2CC2)c1=O |
| InChI | InChI=1S/C21H27N5O5/c1-14-5-6-15(12-18(14)26(29)30)20(27)23-9-3-4-16(13-23)19-22-24(10-11-31-2)21(28)25(19)17-7-8-17/h5-6,12,16-17H,3-4,7-11,13H2,1-2H3 |
| InChIKey | SIKZMGCHZQMQHJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 112.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|