C20H24ClN5O5 — CID 121115762
5-[1-(5-chloro-2-nitrobenzoyl)piperidin-3-yl]-4-cyclopropyl-2-(2-methoxyethyl)-1,2,4-triazol-3-one (PubChem CID 121115762) has the molecular formula C20H24ClN5O5 and a molecular weight of 449.90 g/mol. Its IUPAC name is 5-[1-(5-chloro-2-nitrobenzoyl)piperidin-3-yl]-4-cyclopropyl-2-(2-methoxyethyl)-1,2,4-triazol-3-one.
| Compound Name | 5-[1-(5-chloro-2-nitrobenzoyl)piperidin-3-yl]-4-cyclopropyl-2-(2-methoxyethyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 121115762 |
| Molecular Formula | C20H24ClN5O5 |
| Molecular Weight | 449.90 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 5-[1-(5-chloro-2-nitrobenzoyl)piperidin-3-yl]-4-cyclopropyl-2-(2-methoxyethyl)-1,2,4-triazol-3-one |
| SMILES | COCCn1nc(C2CCCN(C(=O)c3cc(Cl)ccc3[N+](=O)[O-])C2)n(C2CC2)c1=O |
| InChI | InChI=1S/C20H24ClN5O5/c1-31-10-9-24-20(28)25(15-5-6-15)18(22-24)13-3-2-8-23(12-13)19(27)16-11-14(21)4-7-17(16)26(29)30/h4,7,11,13,15H,2-3,5-6,8-10,12H2,1H3 |
| InChIKey | YNAZVATVFGBXSV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 112.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.90 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|