C18H22ClN5O4 — CID 90541193
5-[1-(5-chloro-2-nitrobenzoyl)piperidin-3-yl]-2-methyl-4-propan-2-yl-1,2,4-triazol-3-one (PubChem CID 90541193) has the molecular formula C18H22ClN5O4 and a molecular weight of 407.86 g/mol. Its IUPAC name is 5-[1-(5-chloro-2-nitrobenzoyl)piperidin-3-yl]-2-methyl-4-propan-2-yl-1,2,4-triazol-3-one.
| Compound Name | 5-[1-(5-chloro-2-nitrobenzoyl)piperidin-3-yl]-2-methyl-4-propan-2-yl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 90541193 |
| Molecular Formula | C18H22ClN5O4 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 5-[1-(5-chloro-2-nitrobenzoyl)piperidin-3-yl]-2-methyl-4-propan-2-yl-1,2,4-triazol-3-one |
| SMILES | CC(C)n1c(C2CCCN(C(=O)c3cc(Cl)ccc3[N+](=O)[O-])C2)nn(C)c1=O |
| InChI | InChI=1S/C18H22ClN5O4/c1-11(2)23-16(20-21(3)18(23)26)12-5-4-8-22(10-12)17(25)14-9-13(19)6-7-15(14)24(27)28/h6-7,9,11-12H,4-5,8,10H2,1-3H3 |
| InChIKey | PHVOIEJSPYNUMN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 103.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|