C22H21N5O4 — CID 121116468
(E)-3-(1,3-benzodioxol-5-yl)-N-[2-(4-cyclopropyl-5-oxo-3-pyridin-3-yl-1,2,4-triazol-1-yl)ethyl]prop-2-enamide (PubChem CID 121116468) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[2-(4-cyclopropyl-5-oxo-3-pyridin-3-yl-1,2,4-triazol-1-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[2-(4-cyclopropyl-5-oxo-3-pyridin-3-yl-1,2,4-triazol-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 121116468 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[2-(4-cyclopropyl-5-oxo-3-pyridin-3-yl-1,2,4-triazol-1-yl)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)NCCn1nc(-c2cccnc2)n(C2CC2)c1=O |
| InChI | InChI=1S/C22H21N5O4/c28-20(8-4-15-3-7-18-19(12-15)31-14-30-18)24-10-11-26-22(29)27(17-5-6-17)21(25-26)16-2-1-9-23-13-16/h1-4,7-9,12-13,17H,5-6,10-11,14H2,(H,24,28)/b8-4+ |
| InChIKey | OUNCNMCKLLHUDM-XBXARRHUSA-N |
| XLogP | 2.00 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|