C21H21N3O5S — CID 171137333
3-(1,3-benzodioxol-5-yl)-N-[2-(3-cyclopropyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl)ethyl]prop-2-enamide (PubChem CID 171137333) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[2-(3-cyclopropyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl)ethyl]prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[2-(3-cyclopropyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171137333 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[2-(3-cyclopropyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl)ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)NCCN1c2ccccc2N(C2CC2)S1(=O)=O |
| InChI | InChI=1S/C21H21N3O5S/c25-21(10-6-15-5-9-19-20(13-15)29-14-28-19)22-11-12-23-17-3-1-2-4-18(17)24(16-7-8-16)30(23,26)27/h1-6,9-10,13,16H,7-8,11-12,14H2,(H,22,25) |
| InChIKey | GSWWYDZSUNCFPF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|