C20H27N5O3 — CID 121117990
4-cyclopentyl-2-methyl-5-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]-1,2,4-triazol-3-one (PubChem CID 121117990) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-cyclopentyl-2-methyl-5-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]-1,2,4-triazol-3-one.
| Compound Name | 4-cyclopentyl-2-methyl-5-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 121117990 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 4-cyclopentyl-2-methyl-5-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]-1,2,4-triazol-3-one |
| SMILES | Cn1nc(C2CCN(Cc3ccc([N+](=O)[O-])cc3)CC2)n(C2CCCC2)c1=O |
| InChI | InChI=1S/C20H27N5O3/c1-22-20(26)24(17-4-2-3-5-17)19(21-22)16-10-12-23(13-11-16)14-15-6-8-18(9-7-15)25(27)28/h6-9,16-17H,2-5,10-14H2,1H3 |
| InChIKey | DBQKPWDPEVOYSZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|